| Name |
Mearnsitrin Myricetin 4'-O-methyl ether 3-O-alpha-L-rhamnopyranoside |
| Formula |
C22H22O12 |
| Mw |
478.11112617 |
| CAS RN |
30484-88-9 |
| C_ID |
C00005769
, 
|
| InChIKey |
NAQNISJXKDSYJD-LBQARNLZNA-N |
| InChICode |
InChI=1S/C22H22O12/c1-7-15(27)17(29)18(30)22(32-7)34-21-16(28)14-10(24)5-9(23)6-13(14)33-19(21)8-3-11(25)20(31-2)12(26)4-8/h3-7,15,17-18,22-27,29-30H,1-2H3/t7-,15-,17+,18-,22-/m0/s1 |
| SMILES |
COc1c(O)cc(-c2oc3cc(O)cc(O)c3c(=O)c2O[C@@H]2OC(C)[C@H](O)C(O)[C@@H]2O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Goniothalamus thwaitesii | Ref. |
| Plantae | Dilleniaceae | Doliocarpus spraguei  | Ref. |
| Plantae | Fabaceae | Acacia dealbata | Ref. |
| Plantae | Fabaceae | Acacia irrorata | Ref. |
| Plantae | Fabaceae | Acacia mearnsii  | Ref. |
| Plantae | Fabaceae | Acacia silvestris | Ref. |
| Plantae | Fabaceae | Flemingia stricta  | Ref. |
| Plantae | Myrsinaceae | Lysimachia nummularia  | Ref. |
| Plantae | Myrtaceae | Eugenia jambolana  | Ref. |
| Plantae | Myrtaceae | Syzygium samarangense | Ref. |
|
|
zoom in
| Organism | Doliocarpus spraguei | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
MacKenzie,Phytochem.,8,(1969),1813 |
|---|
|