| Name |
Gossypetin 8-glucoside Gossypin |
| Formula |
C21H20O13 |
| Mw |
480.09039073 |
| CAS RN |
652-78-8 |
| C_ID |
C00005690
, 
|
| InChIKey |
SJRXVLUZMMDCNG-DFWVUPSFNA-N |
| InChICode |
InChI=1S/C21H20O13/c22-5-11-13(27)15(29)17(31)21(32-11)34-19-10(26)4-9(25)12-14(28)16(30)18(33-20(12)19)6-1-2-7(23)8(24)3-6/h1-4,11,13,15,17,21-27,29-31H,5H2/t11-,13-,15+,17-,21+/m1/s1 |
| SMILES |
O=c1c(O)c(-c2ccc(O)c(O)c2)oc2c(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Crassulaceae | Rhodiola rosea  | Ref. |
| Plantae | Malvaceae | Abutilon indicum  | Ref. |
| Plantae | Malvaceae | Gossypium spp. | Ref. |
| Plantae | Malvaceae | Hibiscus vitifolius  | Ref. |
|
|
zoom in
| Organism | Abutilon indicum | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Rao,Proc.Indian Acad.Sci.Sect.A.,25,(1947),397
Subramanian,Phytochem.,11,(1972),1518 |
|---|
|