| Name |
Patuletin 3-O-beta-D-glucoside Patuletin 3-glucoside |
| Formula |
C22H22O13 |
| Mw |
494.10604079 |
| CAS RN |
19833-27-3 |
| C_ID |
C00005639
, 
|
| InChIKey |
AFBZFRQNKMLRPU-XXGUDYNLNA-N |
| InChICode |
InChI=1S/C22H22O13/c1-32-20-10(26)5-11-13(15(20)28)16(29)21(19(33-11)7-2-3-8(24)9(25)4-7)35-22-18(31)17(30)14(27)12(6-23)34-22/h2-5,12,14,17-18,22-28,30-31H,6H2,1H3/t12-,14-,17+,18-,22+/m1/s1 |
| SMILES |
COc1c(O)cc2oc(-c3ccc(O)c(O)c3)c(O[C@@H]3O[C@H](CO)[C@@H](O)C(O)C3O)c(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina saltillensis | Ref. |
| Plantae | Asteraceae | Arnica amplexicaulis | Ref. |
| Plantae | Asteraceae | Arnica mollis | Ref. |
| Plantae | Asteraceae | Arnica montana cv.ARBO  | Ref. |
| Plantae | Asteraceae | Artemisia herba-alba  | Ref. |
| Plantae | Asteraceae | Artemisia monosperma | Ref. |
| Plantae | Asteraceae | Brickellia vernicosa | Ref. |
| Plantae | Asteraceae | Decachaeta ovatifolia | Ref. |
| Plantae | Asteraceae | Desmanthodium spp. | Ref. |
| Plantae | Asteraceae | Eupatorium areolare | Ref. |
| Plantae | Asteraceae | Hymenoxys scaposa | Ref. |
| Plantae | Asteraceae | Lasthenia spp. | Ref. |
| Plantae | Asteraceae | Parthenium rollinsianum | Ref. |
| Plantae | Bromeliaceae | Tillandsia bulbosa | Ref. |
| Plantae | Bromeliaceae | Vriesea regina | Ref. |
| Plantae | Eriocaulaceae | Eriocaulon buergerianum | Ref. |
|
|
zoom in
| Organism | Arnica amplexicaulis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Thomas,Phytochem.,7,(1968),787
Williams,Phytochem.,17,(1978),729 |
|---|
|