| Name |
Rhamnazin 3-glucoside |
| Formula |
C23H24O12 |
| Mw |
492.12677623 |
| CAS RN |
20486-38-8 |
| C_ID |
C00005607
, 
|
| InChIKey |
NULDUMWEBSEHPR-BBUAEBONNA-N |
| InChICode |
InChI=1S/C23H24O12/c1-31-10-6-12(26)16-14(7-10)33-21(9-3-4-11(25)13(5-9)32-2)22(18(16)28)35-23-20(30)19(29)17(27)15(8-24)34-23/h3-7,15,17,19-20,23-27,29-30H,8H2,1-2H3/t15-,17-,19-,20-,23+/m1/s1 |
| SMILES |
COc1cc(O)c2c(=O)c(O[C@@H]3O[C@H](CO)[C@@H](O)C(O)C3O)c(-c3ccc(O)c(OC)c3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Menyanthaceae | Nymphoides fallax | Ref. |
| Plantae | Menyanthaceae | Nymphoides geminata | Ref. |
| Plantae | Rosaceae | Pyrus communis  | Ref. |
| Plantae | Salicaceae | Salix alba  | Ref. |
| Plantae | Santalaceae | Viscum album  | Ref. |
|
|
zoom in
| Organism | Nymphoides geminata | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Thieme,Tetrahedron Lett.,(1968),2301
Ohta,Agric.Biol.Chem.,34,(1970),900 |
|---|
|