| Name |
Tamarixetin 3-galactoside Quercetin 4'-methyl ether 3-galactoside 3-(beta-D-Galactopyranosyloxy)-5,7-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C22H22O12 |
| Mw |
478.11112617 |
| CAS RN |
52305-25-6 |
| C_ID |
C00005590
, 
|
| InChIKey |
JXASPPWQHFOWPL-HTTJNPAHNA-N |
| InChICode |
InChI=1S/C22H22O12/c1-31-12-3-2-8(4-10(12)25)20-21(17(28)15-11(26)5-9(24)6-13(15)32-20)34-22-19(30)18(29)16(27)14(7-23)33-22/h2-6,14,16,18-19,22-27,29-30H,7H2,1H3/t14-,16+,18-,19+,22+/m1/s1 |
| SMILES |
COc1ccc(-c2oc3cc(O)cc(O)c3c(=O)c2O[C@@H]2O[C@H](CO)[C@H](O)C(O)C2O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Amsonia ciliata | Ref. |
| Plantae | Apocynaceae | Cynanchum thesioides  | Ref. |
| Plantae | Apocynaceae | Thevetia neriifolia | Ref. |
|
|
zoom in
| Organism | Cynanchum thesioides | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Gunasegaran,Indian J.Chem.Sect.B.,20,(1981),832
Yuan,Yaoxue Xuebao,27,(1992),589 |
|---|
|