| Name |
Isorhamnetin 3-sophoroside-7-glucoside |
| Formula |
C34H42O22 |
| Mw |
802.21677303 |
| CAS RN |
17331-29-2 |
| C_ID |
C00005579
, 
|
| InChIKey |
GFXVHGLRIICEQY-XUQPBMSLNA-N |
| InChICode |
InChI=1S/C34H42O22/c1-49-14-4-10(2-3-12(14)38)29-30(23(43)19-13(39)5-11(6-15(19)51-29)50-32-27(47)24(44)20(40)16(7-35)52-32)55-34-31(26(46)22(42)18(9-37)54-34)56-33-28(48)25(45)21(41)17(8-36)53-33/h2-6,16-18,20-22,24-28,31-42,44-48H,7-9H2,1H3/t16-,17-,18+,20-,21-,22-,24+,25+,26+,27+,28-,31-,32-,33+,34+/m1/s1 |
| SMILES |
COc1cc(-c2oc3cc(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)cc(O)c3c(=O)c2O[C@@H]2OC(CO)[C@@H](O)C(O)C2O[C@@H]2OC(CO)[C@@H](O)C(O)[C@H]2O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
| Plantae | Cruciferae | Brassica napus  | Ref. |
| Plantae | Cruciferae | Sinapis arvensis  | Ref. |
| Plantae | Elaeagnaceae | Elaeagnus montana | Ref. |
| Plantae | Elaeagnaceae | Elaeagnus multiflora | Ref. |
|
|
zoom in
| Organism | Brassica napus | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Horhammer,Chem.Ber.,100,(1967),2301 |
|---|
|