| Name |
Isorhamnetin 7-O-beta-D-glucopyranoside Isorhamnetin 7-glucoside |
| Formula |
C22H22O12 |
| Mw |
478.11112617 |
| CAS RN |
6743-96-0 |
| C_ID |
C00005530
, 
|
| InChIKey |
YCUNOXSUHVGZRI-XJHYHYQANA-N |
| InChICode |
InChI=1S/C22H22O12/c1-31-12-4-8(2-3-10(12)24)21-19(29)17(27)15-11(25)5-9(6-13(15)33-21)32-22-20(30)18(28)16(26)14(7-23)34-22/h2-6,14,16,18,20,22-26,28-30H,7H2,1H3/t14-,16+,18-,20-,22+/m0/s1 |
| SMILES |
COc1cc(-c2oc3cc(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)cc(O)c3c(=O)c2O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Clibadium sessile | Ref. |
| Plantae | Asteraceae | Cnicus mallichi | Ref. |
| Plantae | Asteraceae | Robinsonia gracilis | Ref. |
| Plantae | Crassulaceae | Sedum acre  | Ref. |
| Plantae | Crassulaceae | Sedum album  | Ref. |
| Plantae | Crassulaceae | Sedum alfredi | Ref. |
| Plantae | Crassulaceae | Sedum sarmentosum  | Ref. |
| Plantae | Cruciferae | Brassica napus  | Ref. |
| Plantae | Cruciferae | Sinapis arvensis  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Plumbaginaceae | Limonium sinuatum  | Ref. |
| Plantae | Rubiaceae | Coprosma spp. | Ref. |
| Plantae | Rutaceae | Haplophyllum robustum | Ref. |
| Plantae | Rutaceae | Zanthoxylum bungeanum  | Ref. |
|
|
zoom in
| Organism | Cnicus mallichi | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Horhammer,Tetrahedron Lett.,(1966),567
Wilson,N.Z.J.Bot.,22,(1984),195 |
|---|
|