| Name |
Isorhamnetin 5-glucoside |
| Formula |
C22H22O12 |
| Mw |
478.11112617 |
| CAS RN |
34199-20-7 |
| C_ID |
C00005529
, 
|
| InChIKey |
SEWSFPXRFAJLGT-XJHYHYQANA-N |
| InChICode |
InChI=1S/C22H22O12/c1-31-11-4-8(2-3-10(11)25)21-19(29)17(27)15-12(32-21)5-9(24)6-13(15)33-22-20(30)18(28)16(26)14(7-23)34-22/h2-6,14,16,18,20,22-26,28-30H,7H2,1H3/t14-,16-,18+,20-,22-/m1/s1 |
| SMILES |
COc1cc(-c2oc3cc(O)cc(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)c3c(=O)c2O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Anacyclus spp. | Ref. |
| Plantae | Asteraceae | Artemisia monosperma | Ref. |
| Plantae | Asteraceae | Centaurea spp. | Ref. |
| Plantae | Asteraceae | Chrysanthemum arcticum | Ref. |
| Plantae | Asteraceae | Cotula australis | Ref. |
| Plantae | Asteraceae | Cotula barbata | Ref. |
| Plantae | Asteraceae | Cotula turbinata | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
|
|
zoom in
| Organism | Artemisia monosperma | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Glennie,Phytochem.,10,(1971),1325 |
|---|
|