| Name |
Azaleatin 3-galactoside |
| Formula |
C22H22O12 |
| Mw |
478.11112617 |
| CAS RN |
28454-85-5 |
| C_ID |
C00005498
, 
|
| InChIKey |
HJOBXPHWOUTSLV-KFIGOVKDNA-N |
| InChICode |
InChI=1S/C22H22O12/c1-31-12-5-9(24)6-13-15(12)17(28)21(20(32-13)8-2-3-10(25)11(26)4-8)34-22-19(30)18(29)16(27)14(7-23)33-22/h2-6,14,16,18-19,22-27,29-30H,7H2,1H3/t14-,16-,18-,19+,22-/m0/s1 |
| SMILES |
COc1cc(O)cc2oc(-c3ccc(O)c(O)c3)c(O[C@@H]3OC(CO)[C@H](O)C(O)C3O)c(=O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Achillea nobilis  | Ref. |
| Plantae | Asteraceae | Achillea ulumoffii | Ref. |
| Plantae | Cunoniaceae | Eucryphia glutinosa | Ref. |
| Plantae | Ericaceae | Rhododendron obtusum | Ref. |
| Plantae | Ericaceae | Rhododendron simsii | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Plumbaginaceae | Ceratostigma plumbaginoides | Ref. |
| Plantae | Plumbaginaceae | Ceratostigma willmottianum | Ref. |
|
|
zoom in
| Organism | Achillea ulumoffii | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Bate-Smith,Phytochem.,6,(1967),1407
Horhammer,Chem.Ber.,102,(1969),792 |
|---|
|