| Name |
Kaempferol 3-isorhamninoside Kaempferol 3-O-isorhamninoside |
| Formula |
C33H40O19 |
| Mw |
740.2163791 |
| CAS RN |
123618-28-0 |
| C_ID |
C00005203
, 
|
| InChIKey |
YZCAVCYYHPLAIN-LIUMSOLRNA-N |
| InChICode |
InChI=1S/C33H40O19/c1-10-19(37)22(40)25(43)32(47-10)51-28-11(2)48-31(27(45)24(28)42)46-9-17-20(38)23(41)26(44)33(50-17)52-30-21(39)18-15(36)7-14(35)8-16(18)49-29(30)12-3-5-13(34)6-4-12/h3-8,10-11,17,19-20,22-28,31-38,40-45H,9H2,1-2H3/t10-,11-,17-,19-,20-,22-,23+,24+,25+,26-,27-,28-,31+,32-,33-/m0/s1 |
| SMILES |
CC1O[C@@H](O[C@H]2C(C)O[C@@H](OCC3O[C@@H](Oc4c(-c5ccc(O)cc5)oc5cc(O)cc(O)c5c4=O)C(O)C(O)[C@H]3O)C(O)[C@H]2O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Actinidiaceae | Actinidia arguta  | Ref. |
| Plantae | Actinidiaceae | Actinidia polygama  | Ref. |
| Plantae | Fabaceae | Macroptilium lathyroides | Ref. |
| Plantae | Fabaceae | Phaseolus lunatus  | Ref. |
| Plantae | Fabaceae | Vigna luteola | Ref. |
| Plantae | Rhamnaceae | Rhamnus alaternus  | Ref. |
| Plantae | Rhamnaceae | Rhamnus nakaharai | Ref. |
|
|
zoom in
| Organism | Actinidia polygama | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Webby,Phytochem.,29,(1990),289
Lin,J.Nat.Prod.,57,(1994),294 |
|---|
|