| Name |
Kaempferol 3-neohesperidoside |
| Formula |
C27H30O15 |
| Mw |
594.15847029 |
| CAS RN |
32602-81-6 |
| C_ID |
C00005167
, 
|
| InChIKey |
OHOBPOYHROOXEI-BJNXDYKJNA-N |
| InChICode |
InChI=1S/C27H30O15/c1-9-17(32)20(35)22(37)26(38-9)42-25-21(36)18(33)15(8-28)40-27(25)41-24-19(34)16-13(31)6-12(30)7-14(16)39-23(24)10-2-4-11(29)5-3-10/h2-7,9,15,17-18,20-22,25-33,35-37H,8H2,1H3/t9-,15-,17+,18-,20-,21-,22+,25-,26+,27+/m1/s1 |
| SMILES |
CC1O[C@@H](OC2C(O)[C@H](O)C(CO)O[C@H]2Oc2c(-c3ccc(O)cc3)oc3cc(O)cc(O)c3c2=O)[C@@H](O)C(O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Alangium platanifolium | Ref. |
| Plantae | Cruciferae | Nerisyrenia linearifolia | Ref. |
| Plantae | Fabaceae | Cassia fistula | Ref. |
| Plantae | Fabaceae | Clitoria ternata | Ref. |
| Plantae | Fabaceae | Clitoria ternatea | Ref. |
| Plantae | Fabaceae | Glycine max | Ref. |
| Plantae | Fabaceae | Indigofera mysorensis | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba | Ref. |
| Plantae | Rosaceae | Crataegus monogyna | Ref. |
| Plantae | Solanaceae | Solanum spp. | Ref. |
| Plantae | Typhaceae | Typha spp. | Ref. |
| Plantae | Urticaceae | Parietaria officinalis | Ref. |
|
|
zoom in
| Organism | Alangium platanifolium |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Vancranenbroeck,Eur.Brew.Conv.Proc.Cogr.,12,(1969),29
Bacon,Phytochem.,14,(1975),295 |
|---|
|
