| Name |
Conyzatin |
| Formula |
C20H20O9 |
| Mw |
404.11073224 |
| CAS RN |
62953-00-8 |
| C_ID |
C00004846
, 
|
| InChIKey |
WFUOMXZWZFSZEM-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H20O9/c1-24-12-6-9(7-13(25-2)18(12)27-4)16-20(28-5)15(23)14-10(21)8-11(22)17(26-3)19(14)29-16/h6-8,21-22H,1-5H3 |
| SMILES |
COc1cc(-c2oc3c(OC)c(O)cc(O)c3c(=O)c2OC)cc(OC)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Conyza sticta | Ref. |
| Plantae | Asteraceae | Conyza stricta  | Ref. |
| Plantae | Asteraceae | Gutierrezia microcephala | Ref. |
| Plantae | Asteraceae | Heteromma simplicifolium | Ref. |
|
|
zoom in
| Organism | Conyza stricta | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Sen,Indian J.Chem.Sect.B,14,(1976),849
Horie,Phytochem.,27,(1988),1491 |
|---|
|