| Name |
5,3'-Dihydroxy-3,6,7,4',5'-pentamethoxyflavone |
| Formula |
C20H20O9 |
| Mw |
404.11073224 |
| CAS RN |
72357-40-5 |
| C_ID |
C00004834
, 
|
| InChIKey |
VGUJFXQAVCKLOB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H20O9/c1-24-12-7-9(6-10(21)18(12)26-3)17-20(28-5)16(23)14-11(29-17)8-13(25-2)19(27-4)15(14)22/h6-8,21-22H,1-5H3 |
| SMILES |
COc1cc(-c2oc3cc(OC)c(OC)c(O)c3c(=O)c2OC)cc(O)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Centipeda orbicularis  | Ref. |
| Plantae | Capparaceae | Cleome amplyocarpa | Ref. |
| Plantae | Capparaceae | Cleome droserifolia  | Ref. |
| Plantae | Rubiaceae | Gardenia fosbergii | Ref. |
|
|
zoom in
| Organism | Cleome amplyocarpa | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Gunatilaka,J.Chem.Res.(S),(1979),216 |
|---|
|