| Name |
Brickellin |
| Formula |
C20H20O9 |
| Mw |
404.11073224 |
| CAS RN |
90357-63-4 |
| C_ID |
C00004818
, 
|
| InChIKey |
USWPTYUGAMOLAB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H20O9/c1-24-11-6-9(10(21)7-12(11)25-2)18-20(28-5)17(23)15-13(29-18)8-14(26-3)19(27-4)16(15)22/h6-8,21-22H,1-5H3 |
| SMILES |
COc1cc(O)c(-c2oc3cc(OC)c(OC)c(O)c3c(=O)c2OC)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Brickellia glutinosa | Ref. |
| Plantae | Asteraceae | Eupatorium buniifolium | Ref. |
| Plantae | Asteraceae | Gutierrezia microcephala | Ref. |
| Plantae | Boraginaceae | Cordia verbenacea  | Ref. |
|
|
zoom in
| Organism | Eupatorium buniifolium | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Van de Velde,J.Chem.Soc.Perkin Trans.,1,(1982),2697
Goodwin,J.Nat.Prod.,47,(1984),711 |
|---|
|