| Name |
5-Hydroxy-3,6,7,8,3'4'-hexamethoxyflavone 2-(3,4-Dimethoxyphenyl)-5-hydroxy-3,6,7,8-tetramethoxy-4H-1-benzopyran-4-one |
| Formula |
C21H22O9 |
| Mw |
418.1263823 |
| CAS RN |
1176-88-1 |
| C_ID |
C00004802
, 
|
| InChIKey |
JDVPHCLYMGBZLE-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C21H22O9/c1-24-11-8-7-10(9-12(11)25-2)16-18(26-3)14(22)13-15(23)19(27-4)21(29-6)20(28-5)17(13)30-16/h7-9,23H,1-6H3 |
| SMILES |
COc1ccc(-c2oc3c(OC)c(OC)c(OC)c(O)c3c(=O)c2OC)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cleomaceae | Polanisia trachysperma | Ref. |
| Plantae | Rutaceae | Acronychia porteri | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
|
|
zoom in
| Organism | Acronychia porteri | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Tatum,Phytochem.,11,(1972),2283 |
|---|
|