| Name |
Myricetin 3,3',4',5'-tetramethyl ether 5,7-Dihydroxy-3,3',4',5'-tetramethoxyflavone 5,7-Dihydroxy-3-methoxy-2-(3,4,5-trimethoxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C19H18O8 |
| Mw |
374.10016755 |
| CAS RN |
14585-04-7 |
| C_ID |
C00004776
, 
|
| InChIKey |
YSXLGTWJLNLXKQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O8/c1-23-13-5-9(6-14(24-2)18(13)25-3)17-19(26-4)16(22)15-11(21)7-10(20)8-12(15)27-17/h5-8,20-21H,1-4H3 |
| SMILES |
COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2OC)cc(OC)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Gutierrezia alamanii | Ref. |
| Plantae | Betulaceae | Betula nigra  | Ref. |
| Plantae | Cistaceae | Cistus albanicus | Ref. |
| Plantae | Cistaceae | Cistus symphytifolius | Ref. |
| Plantae | Phyllanthaceae | Bridelia ferruginea  | Ref. |
| Plantae | Rubiaceae | Adina cordifolia  | Ref. |
|
|
zoom in
| Organism | Betula nigra | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Srivastava,Indian J.Chem.,20,(1981),833 |
|---|
|