| Name |
Myricetin 3,7,4'-trimethyl ether 5,3',5'-Trihydroxy-3,7,4'-trimethoxyflavone 2-(3,5-Dihydroxy-4-methoxyphenyl)-5-hydroxy-3,7-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C18H16O8 |
| Mw |
360.08451749 |
| CAS RN |
15868-40-3 |
| C_ID |
C00004769
, 
|
| InChIKey |
XWQRPAOBLCGIRQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O8/c1-23-9-6-10(19)14-13(7-9)26-16(18(25-3)15(14)22)8-4-11(20)17(24-2)12(21)5-8/h4-7,19-21H,1-3H3 |
| SMILES |
COc1cc(O)c2c(=O)c(OC)c(-c3cc(O)c(OC)c(O)c3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Gutierrezia alamanii | Ref. |
| Plantae | Asteraceae | Xanthocephalum gymnospermoides | Ref. |
| Plantae | Cistaceae | Cistus spp. | Ref. |
| Plantae | Crassulaceae | Aeonium sedifolium | Ref. |
| Plantae | Euphorbiaceae | Ricinocarpos stylosus | Ref. |
|
|
zoom in
| Organism | Xanthocephalum gymnospermoides | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Henrick,Aust.J.Chem.,17,(1964),934 |
|---|
|