| Name |
Myricetin 3,4'-dimethyl ether |
| Formula |
C17H14O8 |
| Mw |
346.06886743 |
| CAS RN |
71325-90-1 |
| C_ID |
C00004764
, 
|
| InChIKey |
MVJHAGLBHWPKLS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O8/c1-23-16-10(20)3-7(4-11(16)21)15-17(24-2)14(22)13-9(19)5-8(18)6-12(13)25-15/h3-6,18-21H,1-2H3 |
| SMILES |
COc1c(O)cc(-c2oc3cc(O)cc(O)c3c(=O)c2OC)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Gutierrezia grandis | Ref. |
| Plantae | Asteraceae | Gutierrezia texana | Ref. |
| Plantae | Didiereaceae | Alluaudia ascendens | Ref. |
| Plantae | Didiereaceae | Decaryia madagascariensis | Ref. |
|
|
zoom in
| Organism | Gutierrezia texana | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Rabesa,Phytochem.,18,(1979),360 |
|---|
|