| Name |
Gossypetin 3,7,3'-trimethyl ether |
| Formula |
C18H16O8 |
| Mw |
360.08451749 |
| CAS RN |
56305-02-3 |
| C_ID |
C00004734
, 
|
| InChIKey |
MNPHMLPMBGJDJI-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O8/c1-23-11-6-8(4-5-9(11)19)16-18(25-3)15(22)13-10(20)7-12(24-2)14(21)17(13)26-16/h4-7,19-21H,1-3H3 |
| SMILES |
COc1cc(-c2oc3c(O)c(OC)cc(O)c3c(=O)c2OC)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Pteridaceae | Notholaena aschenborniana | Ref. |
| Plantae | Zygophyllaceae | Larrea divaricata  | Ref. |
| Plantae | Zygophyllaceae | Larrea tridentata  | Ref. |
|
|
zoom in
| Organism | Larrea divaricata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|