| Name |
Gossypetin 3,8-dimethyl ether 5,7,3',4'-Tetrahydroxy-3,8-dimethoxyflavone 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3,8-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C17H14O8 |
| Mw |
346.06886743 |
| CAS RN |
4988-22-1 |
| C_ID |
C00004727
, 
|
| InChIKey |
RRYQDECFPVYHLR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O8/c1-23-15-11(21)6-10(20)12-13(22)17(24-2)14(25-16(12)15)7-3-4-8(18)9(19)5-7/h3-6,18-21H,1-2H3 |
| SMILES |
COc1c(-c2ccc(O)c(O)c2)oc2c(OC)c(O)cc(O)c2c1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Encelia densifolia | Ref. |
| Plantae | Asteraceae | Enceliopsis nudicaulis | Ref. |
| Plantae | Asteraceae | Geraea canescens | Ref. |
| Plantae | Asteraceae | Gutierrezia spp. | Ref. |
| Plantae | Asteraceae | Hemizonia spp. | Ref. |
| Plantae | Asteraceae | Madia sativa  | Ref. |
| Plantae | Asteraceae | Ozothamnus hookeri | Ref. |
| Plantae | Cleomaceae | Polanisia trachysperma | Ref. |
| Plantae | Euphorbiaceae | Ricinocarpos muricatus | Ref. |
|
|
zoom in
| Organism | Enceliopsis nudicaulis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Henrick,Tetrahedron,21,(1965),3219 |
|---|
|