| Name |
Quercetagetin 3,5,6,3',4'-pentamethyl ether 7-Hydroxy-3,5,6,3',4'-pentamethoxyflavone 2-(3,4-Dimethoxyphenyl)-7-hydroxy-3,5,6-trimethoxy-4H-1-benzopyran-4-one |
| Formula |
C20H20O8 |
| Mw |
388.11581762 |
| CAS RN |
57393-68-7 |
| C_ID |
C00004711
, 
|
| InChIKey |
DFMQEEUDLFLPFL-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H20O8/c1-23-12-7-6-10(8-13(12)24-2)17-20(27-5)16(22)15-14(28-17)9-11(21)18(25-3)19(15)26-4/h6-9,21H,1-5H3 |
| SMILES |
COc1ccc(-c2oc3cc(O)c(OC)c(OC)c3c(=O)c2OC)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ambrosia grayi | Ref. |
| Plantae | Fabaceae | Phaseolus augustii | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| - | - | Vigua spiralis | Ref. |
|
|
zoom in
| Organism | Phaseolus augustii | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Herz,Tetrahedron Lett.,31(1975),1577 |
|---|
|