| Name |
Quercetagetin 6,7,3',4'-tetramethyl ether 2-(3,4-Dimethoxyphenyl)-3,5-dihydroxy-6,7-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C19H18O8 |
| Mw |
374.10016755 |
| CAS RN |
57296-14-7 |
| C_ID |
C00004709
, 
|
| InChIKey |
QVYSZKIZAPTGSX-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O8/c1-23-10-6-5-9(7-11(10)24-2)18-17(22)15(20)14-12(27-18)8-13(25-3)19(26-4)16(14)21/h5-8,21-22H,1-4H3 |
| SMILES |
COc1ccc(-c2oc3cc(OC)c(OC)c(O)c3c(=O)c2O)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Artemisia lanata | Ref. |
| Plantae | Asteraceae | Baccharis salicina | Ref. |
| Plantae | Asteraceae | Helianthus glaucophyllus | Ref. |
| Plantae | Asteraceae | Helianthus microcephalus | Ref. |
| Plantae | Asteraceae | Heteromma simplicifolium | Ref. |
| Plantae | Asteraceae | Parthenium incanum | Ref. |
| Plantae | Asteraceae | Pericome caudata | Ref. |
|
|
zoom in
| Organism | Artemisia lanata | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Djermanovic,Phytochem.,14,(1975),1873 |
|---|
|