| Name |
Quercetagetin 6,3',4'-trimethyl ether |
| Formula |
C18H16O8 |
| Mw |
360.08451749 |
| CAS RN |
98790-51-3 |
| C_ID |
C00004699
, 
|
| InChIKey |
KDLBPPXQNXUTGJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O8/c1-23-10-5-4-8(6-11(10)24-2)17-16(22)14(20)13-12(26-17)7-9(19)18(25-3)15(13)21/h4-7,19,21-22H,1-3H3 |
| SMILES |
COc1ccc(-c2oc3cc(O)c(OC)c(O)c3c(=O)c2O)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Arnica chamissonis | Ref. |
| Plantae | Asteraceae | Brickellia microphylla | Ref. |
| Plantae | Asteraceae | Decachaeta haenkeana | Ref. |
|
|
zoom in
| Organism | Brickellia microphylla | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Merfort,Planta Med.,51,(1985),136
Miski,Phytochem.,24,(1985),3078 |
|---|
|