| Name |
Quercetagetin 3-methyl ether |
| Formula |
C16H12O8 |
| Mw |
332.05321736 |
| CAS RN |
64190-88-1 |
| C_ID |
C00004678
, 
|
| InChIKey |
QZAXKZRZMAXPSF-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O8/c1-23-16-14(22)11-10(5-9(19)12(20)13(11)21)24-15(16)6-2-3-7(17)8(18)4-6/h2-5,17-21H,1H3 |
| SMILES |
COc1c(-c2ccc(O)c(O)c2)oc2cc(O)c(O)c(O)c2c1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Gutierrezia microcephala | Ref. |
| Plantae | Asteraceae | Gutierrezia texana | Ref. |
| Plantae | Asteraceae | Haplopappus rengifoanus | Ref. |
| Plantae | Asteraceae | Melampodium americanum | Ref. |
| Plantae | Asteraceae | Neurolaena oaxacana | Ref. |
| Plantae | Asteraceae | Pterocaulon purpurascens | Ref. |
|
|
zoom in
| Organism | Gutierrezia microcephala | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Ulubelen,Phytochem.,19,(1980),1761 |
|---|
|