| Name |
3,5,7,3',4'-Pentamethoxyflavone Quercetin pentamethyl ether |
| Formula |
C20H20O7 |
| Mw |
372.12090299 |
| CAS RN |
1247-97-8 |
| C_ID |
C00004655
, 
|
| InChIKey |
ALGDHWVALRSLBT-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H20O7/c1-22-12-9-15(25-4)17-16(10-12)27-19(20(26-5)18(17)21)11-6-7-13(23-2)14(8-11)24-3/h6-10H,1-5H3 |
| SMILES |
COc1cc(OC)c2c(=O)c(OC)c(-c3ccc(OC)c(OC)c3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Callicarpa formosana  | Ref. |
| Plantae | Rutaceae | Melicope triphylla | Ref. |
| Plantae | Zingiberaceae | Amomum koenigii | Ref. |
| Plantae | Zingiberaceae | Boesenbergia pandurata  | Ref. |
| Plantae | Zingiberaceae | Kaempferia parviflora  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Melicope triphylla | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Higa,Yakugaku Zasshi,110,(1990),822 |
|---|
|