| Name |
Viscidulin I |
| Formula |
C15H10O7 |
| Mw |
302.04265268 |
| CAS RN |
92519-95-4 |
| C_ID |
C00004629
, 
|
| InChIKey |
NULZZCUABWZIRV-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O7/c16-6-4-9(19)12-10(5-6)22-15(14(21)13(12)20)11-7(17)2-1-3-8(11)18/h1-5,16-19,21H |
| SMILES |
O=c1c(O)c(-c2c(O)cccc2O)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Labiatae | Scutellaria tenax | Ref. |
| Plantae | Labiatae | Scutellaria viscidula | Ref. |
|
|
zoom in
| Organism | Scutellaria tenax | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Liurong,Yaoxue Xuebao,19,(1984),397
Liu,Yaoxue Xuebao,19,(1984),830 |
|---|
|