| Name |
3,5,7,2',5'-Pentahydroxyflavone |
| Formula |
C15H10O7 |
| Mw |
302.04265268 |
| CAS RN |
|
| C_ID |
C00004627
, 
|
| InChIKey |
FYNCQVXZKZHSTM-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O7/c16-6-1-2-9(18)8(3-6)15-14(21)13(20)12-10(19)4-7(17)5-11(12)22-15/h1-5,16-19,21H |
| SMILES |
O=c1c(O)c(-c2cc(O)ccc2O)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Polygonaceae | Polygonum equiseiforme | Ref. |
|
|
zoom in
| Organism | Polygonum equiseiforme | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|