| Name |
Prudomestin 3,5,7-Trihydroxy-4',8-dimethoxyflavone 3,5,7-Trihydroxy-8-methoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C17H14O7 |
| Mw |
330.0739528 |
| CAS RN |
3443-28-5 |
| C_ID |
C00004618
, 
|
| InChIKey |
HLSIOUXODPWHFI-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O7/c1-22-9-5-3-8(4-6-9)15-14(21)13(20)12-10(18)7-11(19)16(23-2)17(12)24-15/h3-7,18-19,21H,1-2H3 |
| SMILES |
COc1ccc(-c2oc3c(OC)c(O)cc(O)c3c(=O)c2O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Calceolariaceae | Calceolaria irazeunsis | Ref. |
| Plantae | Pteridaceae | Pityrogramma triangularis | Ref. |
| Plantae | Rosaceae | Prunus domestica  | Ref. |
| Plantae | Rutaceae | Zanthoxylum integrifoliolum | Ref. |
|
|
zoom in
| Organism | Pityrogramma triangularis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Nagarajan,Phytochem.,3,(1964),477 |
|---|
|