| Name |
Eupalitin
6,7-Dimethoxy-3,5,4'-trihydroxyflavone
Betuletol
3,5-Dihydroxy-2-(4-hydroxyphenyl)-6,7-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C17H14O7 |
| Mw |
330.0739528 |
| CAS RN |
29536-41-2 |
| C_ID |
C00004599
, 
|
| InChIKey |
KWMAWXWUGIEVDG-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O7/c1-22-11-7-10-12(14(20)17(11)23-2)13(19)15(21)16(24-10)8-3-5-9(18)6-4-8/h3-7,18,20-21H,1-2H3 |
| SMILES |
COc1cc2oc(-c3ccc(O)cc3)c(O)c(=O)c2c(O)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Aizoaceae | Sesuvium portulacastrum  | Ref. |
| Plantae | Asteraceae | Ageratina havanensis | Ref. |
| Plantae | Asteraceae | Artemisia austriaca | Ref. |
| Plantae | Asteraceae | Baccharis pilularis | Ref. |
| Plantae | Asteraceae | Baccharis vaccinioides | Ref. |
| Plantae | Asteraceae | Brickellia longifolia | Ref. |
| Plantae | Asteraceae | Eupatorium areolare | Ref. |
| Plantae | Asteraceae | Eupatorium ligustrinum | Ref. |
| Plantae | Asteraceae | Heterotheca villosa | Ref. |
| Plantae | Asteraceae | Matricaria recutita | Ref. |
| Plantae | Asteraceae | Pluchea odorata | Ref. |
| Plantae | Asteraceae | Rudbeckia serotina | Ref. |
| Plantae | Boraginaceae | Onosma hispida | Ref. |
| Plantae | Crassulaceae | Aeonium glutinosum | Ref. |
| Plantae | Hydrophyllaceae | Eriodictyon trichocalyx | Ref. |
| Plantae | Polemoniaceae | Ipomopsis aggregata | Ref. |
|
|
zoom in
| Organism | Ageratina havanensis |
|---|
| Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
