| Name |
6-Hydroxykaempferol 5,6-dimethyl ether 3,7-Dihydroxy-2-(4-hydroxyphenyl)-5,6-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C17H14O7 |
| Mw |
330.0739528 |
| CAS RN |
87339-62-6 |
| C_ID |
C00004598
, 
|
| InChIKey |
AFEOHOFUAGTTRM-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O7/c1-22-16-10(19)7-11-12(17(16)23-2)13(20)14(21)15(24-11)8-3-5-9(18)6-4-8/h3-7,18-19,21H,1-2H3 |
| SMILES |
COc1c(O)cc2oc(-c3ccc(O)cc3)c(O)c(=O)c2c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Salvia columbariae  | Ref. |
| Plantae | Labiatae | Trichostema lanatum | Ref. |
| Plantae | Rosaceae | Adenostoma sparsifolium | Ref. |
|
|
zoom in
| Organism | Trichostema lanatum | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Proksch,Phytochem.,21,(1982),2893 |
|---|
|