| Name |
3,5-Dihydroxy-7,8-dimethoxyflavone 3,5-Dihydroxy-7,8-dimethoxy-2-phenyl-4H-1-benzopyran-4-one |
| Formula |
C17H14O6 |
| Mw |
314.07903818 |
| CAS RN |
22399-73-1 |
| C_ID |
C00004557
, 
|
| InChIKey |
CILMBWBPHLLNEH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O6/c1-21-11-8-10(18)12-13(19)14(20)15(9-6-4-3-5-7-9)23-17(12)16(11)22-2/h3-8,18,20H,1-2H3 |
| SMILES |
COc1cc(O)c2c(=O)c(O)c(-c3ccccc3)oc2c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Achyrocline bogotensis (HBK.) DC. | Ref. |
| Plantae | Asteraceae | Achyrocline tomentosa  | Ref. |
| Plantae | Asteraceae | Helichrysum italicum  | Ref. |
| Plantae | Asteraceae | Ozothamnus ledifolius | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus solandri | Ref. |
| Plantae | Woodsiaceae/Dryopteridaceae | Woodsia scopulina | Ref. |
|
|
zoom in
| Organism | Achyrocline tomentosa | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Ferraro,J.Nat.Prod.,48,(1985),817 |
|---|
|