| Name |
Alnusin 3,5,7-Trihydroxy-6-methoxyflavone 6-Methoxygalangin 3,5,7-Trihydroxy-6-methoxy-2-phenyl-4H-1-benzopyran-4-one |
| Formula |
C16H12O6 |
| Mw |
300.06338812 |
| CAS RN |
32483-97-9 |
| C_ID |
C00004543
, 
|
| InChIKey |
HYBBOIHJQNYTGH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O6/c1-21-16-9(17)7-10-11(13(16)19)12(18)14(20)15(22-10)8-5-3-2-4-6-8/h2-7,17,19-20H,1H3 |
| SMILES |
COc1c(O)cc2oc(-c3ccccc3)c(O)c(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Anaphalis margaritacea | Ref. |
| Plantae | Asteraceae | Baccharis bigelovii | Ref. |
| Plantae | Asteraceae | Cassinia quinquefaria | Ref. |
| Plantae | Asteraceae | Chromolaena chasleae | Ref. |
| Plantae | Asteraceae | Gnaphalium microcephalum | Ref. |
| Plantae | Betulaceae | Alnus sieboldiana | Ref. |
| Plantae | Rosaceae | Adenostoma sparsifolium | Ref. |
|
|
zoom in
| Organism | Baccharis bigelovii | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Asakawa,Bull.Chem.Soc.Jpn,44,(1971),297
Asakawa,Bull.Chem.Soc.Jpn,44,(1971),2761 |
|---|
|