| Name |
Galangin 5-methyl ether |
| Formula |
C16H12O5 |
| Mw |
284.06847349 |
| CAS RN |
104594-69-6 |
| C_ID |
C00004535
, 
|
| InChIKey |
LDRJANCOJOKOPS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O5/c1-20-11-7-10(17)8-12-13(11)14(18)15(19)16(21-12)9-5-3-2-4-6-9/h2-8,17,19H,1H3 |
| SMILES |
COc1cc(O)cc2oc(-c3ccccc3)c(O)c(=O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Pteridaceae | Notholaena ekmanii | Ref. |
| Plantae | Pteridaceae | Pityrogramma triangularis | Ref. |
| Plantae | Pteridaceae | Platyzoma microphyllum | Ref. |
| Plantae | Salicaceae | Populus gemma | Ref. |
|
|
zoom in
| Organism | Pityrogramma triangularis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Papy,Studies in Organic Chem.,23,(1986)233 |
|---|
|