| Name |
Luteolin 3'-methyl ether 7-rutinoside |
| Formula |
C28H32O15 |
| Mw |
608.17412036 |
| CAS RN |
32061-83-9 |
| C_ID |
C00004343
, 
|
| InChIKey |
FVWCQCCVDNGNPX-GLOFBDNXNA-N |
| InChICode |
InChI=1S/C28H32O15/c1-10-21(32)23(34)25(36)27(40-10)39-9-19-22(33)24(35)26(37)28(43-19)41-12-6-14(30)20-15(31)8-16(42-18(20)7-12)11-3-4-13(29)17(5-11)38-2/h3-8,10,19,21-30,32-37H,9H2,1-2H3/t10-,19+,21-,22+,23-,24-,25+,26+,27+,28+/m0/s1 |
| SMILES |
COc1cc(-c2cc(=O)c3c(O)cc(O[C@@H]4OC(CO[C@@H]5OC(C)[C@H](O)[C@H](O)C5O)[C@@H](O)[C@H](O)C4O)cc3o2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
|
|
zoom in
| Organism | Matricaria chamomilla | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Harborne,Phytochem.,9,(1970),2011 |
|---|
|