| Name |
5,7,4'-Trihydroxy-3'-methoxyflavone Luteolin 3'-methyl ether 7-glucuronide Chrysoeriol 7-O-glucuronide |
| Formula |
C22H20O12 |
| Mw |
476.09547611 |
| CAS RN |
29741-07-9 |
| C_ID |
C00004339
, 
|
| InChIKey |
VLYLVFHVHHGXHX-ACYPGOOPNA-N |
| InChICode |
InChI=1S/C22H20O12/c1-31-14-4-8(2-3-10(14)23)13-7-12(25)16-11(24)5-9(6-15(16)33-13)32-22-19(28)17(26)18(27)20(34-22)21(29)30/h2-7,17-20,22-24,26-28H,1H3,(H,29,30)/t17-,18-,19+,20-,22+/m0/s1 |
| SMILES |
COc1cc(-c2cc(=O)c3c(O)cc(O[C@@H]4OC(C(=O)O)[C@@H](O)[C@H](O)C4O)cc3o2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Asteraceae | Artemisia judaica  | Ref. |
| Plantae | Fabaceae | Medicago arabica | Ref. |
| Plantae | Fabaceae | Medicago polymorpha  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Orobanchaceae | Pedicularis longiflora var. tubiformis | Ref. |
| Plantae | Plantaginaceae | Antirrhinum majus  | Ref. |
|
|
zoom in
| Organism | Artemisia judaica | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Harborne,Phytochem.,2,(1963),327
Saleh,Phytochem.,26,(1987),3059 |
|---|
|