| Name |
Anisofolin A
Apigenin 7-(3'',6''-di-p-coumarylglucoside) |
| Formula |
C39H32O14 |
| Mw |
724.17920573 |
| CAS RN |
83529-71-9 |
| C_ID |
C00004186
, 
|
| InChIKey |
LHMKSPOTCLVAKR-GYANNMOHNA-N |
| InChICode |
InChI=1S/C39H32O14/c40-24-9-1-21(2-10-24)5-15-33(45)49-20-32-36(47)38(53-34(46)16-6-22-3-11-25(41)12-4-22)37(48)39(52-32)50-27-17-28(43)35-29(44)19-30(51-31(35)18-27)23-7-13-26(42)14-8-23/h1-19,32,36-43,47-48H,20H2/b15-5+,16-6+/t32-,36-,37-,38+,39-/m1/s1 |
| SMILES |
O=C(/C=C/c1ccc(O)cc1)OCC1O[C@@H](Oc2cc(O)c3c(=O)cc(-c4ccc(O)cc4)oc3c2)C(O)[C@@H](OC(=O)/C=C/c2ccc(O)cc2)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Anisomeles indica  | Ref. |
| Plantae | Labiatae | Anisomeles ovata | Ref. |
| Plantae | Labiatae | Leucas cephalotes SPRENG. | Ref. |
| Plantae | Labiatae | Stachys lanata | Ref. |
|
|
zoom in
| Organism | Anisomeles ovata |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Rao,Heterocycles,19,(1982),1655 |
|---|
|
