| Name |
Apigenin 7-(6''-acetylglucoside) |
| Formula |
C23H22O11 |
| Mw |
474.11621155 |
| CAS RN |
72741-92-5 |
| C_ID |
C00004177
, 
|
| InChIKey |
LYFXRHUNCZZUTQ-JOGGKIJDNA-N |
| InChICode |
InChI=1S/C23H22O11/c1-10(24)31-9-18-20(28)21(29)22(30)23(34-18)32-13-6-14(26)19-15(27)8-16(33-17(19)7-13)11-2-4-12(25)5-3-11/h2-8,18,20-23,25-26,28-30H,9H2,1H3/t18-,20-,21+,22-,23-/m1/s1 |
| SMILES |
CC(=O)OCC1O[C@@H](Oc2cc(O)c3c(=O)cc(-c4ccc(O)cc4)oc3c2)C(O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Chamomilla recutita (L.) Rauschert  | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
|
|
zoom in
| Organism | Matricaria chamomilla | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Kunde,Planta Med.,37,(1979),124 |
|---|
|