| Name |
Apigenin 7-(6''-p-coumarylglucoside) Apigenin 7-O-(6''-O-p-coumaroylglucoside) Apigenin 7-O-p-coumaroylglucoside Echinacin (-)-Echinacin |
| Formula |
C30H26O12 |
| Mw |
578.1424263 |
| CAS RN |
105815-90-5 |
| C_ID |
C00004172
, 
|
| InChIKey |
WPQRDUGBKUNFJW-ZKPYLLRRNA-N |
| InChICode |
InChI=1S/C30H26O12/c31-17-6-1-15(2-7-17)3-10-25(35)39-14-24-27(36)28(37)29(38)30(42-24)40-19-11-20(33)26-21(34)13-22(41-23(26)12-19)16-4-8-18(32)9-5-16/h1-13,24,27-33,36-38H,14H2/b10-3+/t24-,27-,28+,29+,30-/m1/s1 |
| SMILES |
O=C(/C=C/c1ccc(O)cc1)OCC1O[C@@H](Oc2cc(O)c3c(=O)cc(-c4ccc(O)cc4)oc3c2)C(O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cucurbitaceae | Cucumis sativus  | Ref. |
| Plantae | Labiatae | Pogostemon cablin  | Ref. |
| Plantae | Labiatae | Stachys alopecuros (L.) Benth. | Ref. |
| Plantae | Labiatae | Stachys anisochila Vis.et Panc. | Ref. |
| Plantae | Labiatae | Stachys germanica L.  | Ref. |
| Plantae | Labiatae | Stachys lanata | Ref. |
| Plantae | Labiatae | Stachys officinalis (L.) Trev.  | Ref. |
| Plantae | Labiatae | Stachys palustris L.  | Ref. |
| Plantae | Labiatae | Stachys plumosa Griseb. | Ref. |
| Plantae | Labiatae | Stachys scardica Griseb. | Ref. |
| Plantae | Labiatae | Stachys sylvatica L. | Ref. |
| Plantae | Turneraceae | Turnera diffusa  | Ref. |
| - | - | Echinop echinatus | Ref. |
|
|
zoom in
| Organism | Pogostemon cablin | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Itokawa,Chem.Pharm.Bull.,29,(1981),254 |
|---|
|