| Name |
Apigenin 7-(4''-E-p-coumarylglucoside) Echinaticin |
| Formula |
C30H26O12 |
| Mw |
578.1424263 |
| CAS RN |
105815-91-6 |
| C_ID |
C00004171
, 
|
| InChIKey |
UTUISHMYVAZILQ-VXAAWCFWNA-N |
| InChICode |
InChI=1S/C30H26O12/c31-14-24-29(42-25(36)10-3-15-1-6-17(32)7-2-15)27(37)28(38)30(41-24)39-19-11-20(34)26-21(35)13-22(40-23(26)12-19)16-4-8-18(33)9-5-16/h1-13,24,27-34,37-38H,14H2/b10-3+/t24-,27+,28+,29+,30+/m0/s1 |
| SMILES |
O=C(/C=C/c1ccc(O)cc1)O[C@@H]1C(CO)O[C@@H](Oc2cc(O)c3c(=O)cc(-c4ccc(O)cc4)oc3c2)C(O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Sideritis raeseri | Ref. |
| Plantae | Turneraceae | Turnera diffusa  | Ref. |
|
|
zoom in
| Organism | Turnera diffusa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|