| Name |
Apigenin-7-O-beta-D-rutinoside Apigenin 7-O-rutinoside Apigenin 7-O-beta-rutinoside Apigenin 7-rutinoside |
| Formula |
C27H30O14 |
| Mw |
578.16355567 |
| CAS RN |
552-57-8 |
| C_ID |
C00004156
, 
|
| InChIKey |
FKIYLTVJPDLUDL-XPQRYFGPNA-N |
| InChICode |
InChI=1S/C27H30O14/c1-10-20(31)22(33)24(35)26(38-10)37-9-18-21(32)23(34)25(36)27(41-18)39-13-6-14(29)19-15(30)8-16(40-17(19)7-13)11-2-4-12(28)5-3-11/h2-8,10,18,20-29,31-36H,9H2,1H3/t10-,18+,20-,21+,22-,23-,24-,25-,26+,27+/m0/s1 |
| SMILES |
CC1O[C@@H](OCC2O[C@@H](Oc3cc(O)c4c(=O)cc(-c5ccc(O)cc5)oc4c3)C(O)[C@@H](O)[C@@H]2O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Asteraceae | Onopordum acanthium  | Ref. |
| Plantae | Asteraceae | Saussurea medusa | Ref. |
| Plantae | Biebersteiniaceae | Biebersteinia orphanidis | Ref. |
| Plantae | Caryophyllaceae | Pratia nummularia | Ref. |
| Plantae | Fabaceae | Oxytropis campestris | Ref. |
| Plantae | Labiatae | Mentha aquatica L.  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Salvia horminum  | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus paradisi  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
|
|
zoom in
| Organism | Matricaria recutita | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|