| Name |
Apigenin 5-glucoside Apigenin 5-O-beta-D-glucopyranoside Salipurpin |
| Formula |
C21H20O10 |
| Mw |
432.10564686 |
| CAS RN |
28757-27-9 |
| C_ID |
C00004139
, 
|
| InChIKey |
ZFPMFULXUJZHFG-OHPGNTIMNA-N |
| InChICode |
InChI=1S/C21H20O10/c22-8-16-18(26)19(27)20(28)21(31-16)30-15-6-11(24)5-14-17(15)12(25)7-13(29-14)9-1-3-10(23)4-2-9/h1-7,16,18-24,26-28H,8H2/t16-,18+,19-,20+,21+/m0/s1 |
| SMILES |
O=c1cc(-c2ccc(O)cc2)oc2cc(O)cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cephalotaxaceae | Cephalotaxus koreana | Ref. |
| Plantae | Fabaceae | Amorpha fruticosa | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
|
|
zoom in
| Organism | Amorpha fruticosa | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Goto,J.Pharm.Soc.,58,(1938),933 |
|---|
|