| Name |
5-Hydroxy-7-methoxy-6,8-di-C-methylflavone 5-Hydroxy-7-methoxy-6,8-dimethylflavone Desmosflavone 5-Hydroxy-7-methoxy-6,8-dimethyl-2-phenyl-4H-1-benzopyran-4-one |
| Formula |
C18H16O4 |
| Mw |
296.104859 |
| CAS RN |
14004-56-9 |
| C_ID |
C00004087
, 
|
| InChIKey |
PQZXFPBMXPGZMO-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O4/c1-10-16(20)15-13(19)9-14(12-7-5-4-6-8-12)22-18(15)11(2)17(10)21-3/h4-9,20H,1-3H3 |
| SMILES |
COc1c(C)c(O)c2c(=O)cc(-c3ccccc3)oc2c1C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Desmos chinensis  | Ref. |
| Plantae | Annonaceae | Desmos cochinchinensis  | Ref. |
| Plantae | Myrtaceae | Leptospermum scoparium  | Ref. |
|
|
zoom in
| Organism | Desmos cochinchinensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Wu,J.,Chin.Chem.Lett.,5,(1994),211 |
|---|
|