| Name |
5,6,7,3',4',5'-Hexamethoxyflavone 5,6,7-Trimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C21H22O8 |
| Mw |
402.13146768 |
| CAS RN |
29043-07-0 |
| C_ID |
C00004082
, 
|
| InChIKey |
DYDFNKUHYXHWFM-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C21H22O8/c1-23-15-7-11(8-16(24-2)19(15)26-4)13-9-12(22)18-14(29-13)10-17(25-3)20(27-5)21(18)28-6/h7-10H,1-6H3 |
| SMILES |
COc1cc(-c2cc(=O)c3c(OC)c(OC)c(OC)cc3o2)cc(OC)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina conyzoides | Ref. |
| Plantae | Asteraceae | Ageratum conyzoides  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Rutaceae | Neoraputia paraensis | Ref. |
|
|
zoom in
| Organism | Ageratum conyzoides | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Horie,Phytochem.,32,(1993),1076 |
|---|
|