| Name |
Isoetin 7,2',4',5'-tetramethyl ether 5-Hdroxy-7,2',4',5'-tetramethoxyflavone 5-Hydroxy-7-methoxy-2-(2,4,5-trimethoxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C19H18O7 |
| Mw |
358.10525293 |
| CAS RN |
159119-07-0 |
| C_ID |
C00004076
, 
|
| InChIKey |
JZIWGWPCBNNLJD-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O7/c1-22-10-5-12(20)19-13(21)8-15(26-18(19)6-10)11-7-16(24-3)17(25-4)9-14(11)23-2/h5-9,20H,1-4H3 |
| SMILES |
COc1cc(O)c2c(=O)cc(-c3cc(OC)c(OC)cc3OC)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia campestris subsp. Glutinosa  | Ref. |
| Plantae | Fabaceae | Calliandra californica | Ref. |
|
|
zoom in
| Organism | Calliandra californica | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Encarnacion,J.Nat.Prod.,57,(1994),1307 |
|---|
|