| Name |
Cyclomulberrin |
| Formula |
C25H24O6 |
| Mw |
420.1572885 |
| CAS RN |
19275-51-5 |
| C_ID |
C00004061
, 
|
| InChIKey |
SYFDWXWLRGHYAJ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C25H24O6/c1-12(2)5-7-15-17(27)11-18(28)21-23(29)22-20(9-13(3)4)30-19-10-14(26)6-8-16(19)25(22)31-24(15)21/h5-6,8-11,20,26-28H,7H2,1-4H3/t20-/m1/s1 |
| SMILES |
CC(C)=CCc1c(O)cc(O)c2c(=O)c3c(oc12)-c1ccc(O)cc1OC3C=C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Moraceae | Artocarpus altilis  | Ref. |
| Plantae | Moraceae | Morus alba | Ref. |
| Plantae | Moraceae | Morus spp. | Ref. |
|
|
zoom in
| Organism | Morus alba |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Deshpande,Tetrahedron Lett.,(1968),1715 |
|---|
|
