| Name |
Cannflavin B 6-Prenylchrysoeriol Canniflavone Canniflavone 1 5,7-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one |
| Formula |
C21H20O6 |
| Mw |
368.12598837 |
| CAS RN |
76735-58-5 |
| C_ID |
C00004036
, 
|
| InChIKey |
IXCUTZUASDSIJO-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C21H20O6/c1-11(2)4-6-13-15(23)9-19-20(21(13)25)16(24)10-17(27-19)12-5-7-14(22)18(8-12)26-3/h4-5,7-10,22-23,25H,6H2,1-3H3 |
| SMILES |
COc1cc(-c2cc(=O)c3c(O)c(CC=C(C)C)c(O)cc3o2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cannabaceae | Cannabis indica | Ref. |
| Plantae | Cannabaceae | Cannabis sativa  | Ref. |
| Plantae | Moraceae | Dorstenia mannii | Ref. |
|
|
zoom in
| Organism | Cannabis sativa | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Barrett,Experientia,42,(1986),452 |
|---|
|