| Name |
Artocarpesin 2',4',5,7-Tetrahydroxy-6-(3-methyl-2-butenyl)flavone 2-(2,4-Dihydroxyphenyl)-5,7-dihydroxy-6-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one |
| Formula |
C20H18O6 |
| Mw |
354.11033831 |
| CAS RN |
3162-09-2 |
| C_ID |
C00004025
, 
|
| InChIKey |
YWUVFGZTDLJVCR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H18O6/c1-10(2)3-5-13-15(23)8-18-19(20(13)25)16(24)9-17(26-18)12-6-4-11(21)7-14(12)22/h3-4,6-9,21-23,25H,5H2,1-2H3 |
| SMILES |
CC(C)=CCc1c(O)cc2oc(-c3ccc(O)cc3O)cc(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Moraceae | Artocarpus elasticus  | Ref. |
| Plantae | Moraceae | Artocarpus heterophyllus  | Ref. |
| Plantae | Moraceae | Cudrania cochinchinensis  | Ref. |
| Plantae | Moraceae | Maclura pomifera | Ref. |
|
|
zoom in
| Organism | Artocarpus heterophyllus | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Venkataraman,Phytochem.,11,(1972),1571 |
|---|
|