| Name |
Albanin A |
| Formula |
C20H18O6 |
| Mw |
354.11033831 |
| CAS RN |
73343-42-7 |
| C_ID |
C00004024
, 
|
| InChIKey |
KEIIIPKLVSSAEI-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H18O6/c1-10(2)3-5-14-19(25)18-16(24)8-12(22)9-17(18)26-20(14)13-6-4-11(21)7-15(13)23/h3-4,6-9,21-24H,5H2,1-2H3 |
| SMILES |
CC(C)=CCc1c(-c2ccc(O)cc2O)oc2cc(O)cc(O)c2c1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Nectriaceae | Fusarium solani | Ref. |
| Plantae | Moraceae | Brosimopsis oblongifolia | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
|
|
zoom in
| Organism | Brosimopsis oblongifolia | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Ferrari,Planta Med.,55,(1989),70 |
|---|
|