| Name |
7-Methoxy-3',4'-methylenedioxyflavone Milleyanaflavone 2-(1,3-Benzodioxol-5-yl)-7-methoxy-4H-1-benzopyran-4-one |
| Formula |
C17H12O5 |
| Mw |
296.06847349 |
| CAS RN |
58996-65-9 |
| C_ID |
C00003997
, 
|
| InChIKey |
IXKYKSQHLUAYFH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H12O5/c1-19-11-3-4-12-13(18)8-15(22-16(12)7-11)10-2-5-14-17(6-10)21-9-20-14/h2-8H,9H2,1H3 |
| SMILES |
COc1ccc2c(=O)cc(-c3ccc4c(c3)OCO4)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Millettia erythrocalyx | Ref. |
| Plantae | Fabaceae | Millettia hemsleyana | Ref. |
| Plantae | Fabaceae | Millettia leucantha | Ref. |
|
|
zoom in
| Organism | Millettia hemsleyana | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Mahmoud,Phytochem.,24,(1985),369 |
|---|
|