| Name |
5,4'-Dihidroxy-6,7,8,3'-tetramethoxyflavone 7-Methylsudachitin 8-Methoxycirsilineol 5-Hydroxy-2-(4-hydroxy-3-methoxyphenyl)-6,7,8-trimethoxy-4H-1-benzopyran-4-one 5,4'-Dihydroxy-6,7,8,3'-tetramethoxyflavone |
| Formula |
C19H18O8 |
| Mw |
374.10016755 |
| CAS RN |
16520-78-8 |
| C_ID |
C00003932
, 
|
| InChIKey |
UBZBPKARIHPOEC-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O8/c1-23-13-7-9(5-6-10(13)20)12-8-11(21)14-15(22)17(24-2)19(26-4)18(25-3)16(14)27-12/h5-8,20,22H,1-4H3 |
| SMILES |
COc1cc(-c2cc(=O)c3c(O)c(OC)c(OC)c(OC)c3o2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ambrosia deltoidea | Ref. |
| Plantae | Asteraceae | Baccharis quitensis | Ref. |
| Plantae | Asteraceae | Calycadenia multiglandulosa | Ref. |
| Plantae | Asteraceae | Madia dissitiflora | Ref. |
| Plantae | Asteraceae | Pteronia incana | Ref. |
| Plantae | Capparaceae | Cleome droserifolia  | Ref. |
| Plantae | Labiatae | Cunila angustifolia | Ref. |
| Plantae | Labiatae | Micromeria albanica | Ref. |
| Plantae | Labiatae | Origanum calcaratum | Ref. |
| Plantae | Labiatae | Origanum dictamnus  | Ref. |
| Plantae | Labiatae | Origanum floribundum | Ref. |
| Plantae | Labiatae | Origanum majorana  | Ref. |
| Plantae | Labiatae | Origanum microphyllum | Ref. |
| Plantae | Labiatae | Origanum onites  | Ref. |
| Plantae | Labiatae | Origanum syriacum  | Ref. |
| Plantae | Labiatae | Origanum vulgare subsp. Glandulosum  | Ref. |
| Plantae | Labiatae | Origanum vulgare subsp. Hirtum  | Ref. |
| Plantae | Labiatae | Sideritis angustifolia | Ref. |
| Plantae | Labiatae | Sideritis flavovitens | Ref. |
| Plantae | Labiatae | Sideritis mugronensis | Ref. |
| Plantae | Labiatae | Thymus herba-barona  | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sudachi  | Ref. |
|
|
zoom in
| Organism | Baccharis quitensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Rodriguez,Phytochem.,16,(1977),800
Wollenweber,Fitoterapia,60,(1989),249 |
|---|
|